C18H31N7O — CID 58291011
4-amino-2-(butylamino)-7-[3-(4-methylpiperazin-1-yl)propyl]-5H-pyrrolo[2,3-d]pyrimidin-6-one (PubChem CID 58291011) has the molecular formula C18H31N7O and a molecular weight of 361.49 g/mol. Its IUPAC name is 4-amino-2-(butylamino)-7-[3-(4-methylpiperazin-1-yl)propyl]-5H-pyrrolo[2,3-d]pyrimidin-6-one.
| Compound Name | 4-amino-2-(butylamino)-7-[3-(4-methylpiperazin-1-yl)propyl]-5H-pyrrolo[2,3-d]pyrimidin-6-one |
|---|---|
| PubChem CID | 58291011 |
| Molecular Formula | C18H31N7O |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.26 |
| IUPAC Name | 4-amino-2-(butylamino)-7-[3-(4-methylpiperazin-1-yl)propyl]-5H-pyrrolo[2,3-d]pyrimidin-6-one |
| SMILES | CCCCNc1nc(N)c2c(n1)N(CCCN1CCN(C)CC1)C(=O)C2 |
| InChI | InChI=1S/C18H31N7O/c1-3-4-6-20-18-21-16(19)14-13-15(26)25(17(14)22-18)8-5-7-24-11-9-23(2)10-12-24/h3-13H2,1-2H3,(H3,19,20,21,22) |
| InChIKey | UKPXOGGVPWGGBF-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 90.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|