C17H29N7O — CID 58291019
4-amino-2-(butylamino)-7-[2-(4-methylpiperazin-1-yl)ethyl]-5H-pyrrolo[2,3-d]pyrimidin-6-one (PubChem CID 58291019) has the molecular formula C17H29N7O and a molecular weight of 347.47 g/mol. Its IUPAC name is 4-amino-2-(butylamino)-7-[2-(4-methylpiperazin-1-yl)ethyl]-5H-pyrrolo[2,3-d]pyrimidin-6-one.
| Compound Name | 4-amino-2-(butylamino)-7-[2-(4-methylpiperazin-1-yl)ethyl]-5H-pyrrolo[2,3-d]pyrimidin-6-one |
|---|---|
| PubChem CID | 58291019 |
| Molecular Formula | C17H29N7O |
| Molecular Weight | 347.47 g/mol |
| Exact Mass | 347.24 |
| IUPAC Name | 4-amino-2-(butylamino)-7-[2-(4-methylpiperazin-1-yl)ethyl]-5H-pyrrolo[2,3-d]pyrimidin-6-one |
| SMILES | CCCCNc1nc(N)c2c(n1)N(CCN1CCN(C)CC1)C(=O)C2 |
| InChI | InChI=1S/C17H29N7O/c1-3-4-5-19-17-20-15(18)13-12-14(25)24(16(13)21-17)11-10-23-8-6-22(2)7-9-23/h3-12H2,1-2H3,(H3,18,19,20,21) |
| InChIKey | YKLPTJNQLIDGCY-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 90.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.47 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|