C29H52O7 — CID 58291172
[(E,2S,5S)-5-[(4S,6S)-6-ethyl-2-(methoxymethyl)-5,5-dimethyl-1,3-dioxan-4-yl]-3,4-dimethylhex-3-en-2-yl] (3R)-5-(methoxymethyl)-3-(2-methylpropyl)oxolane-2-carboxylate (PubChem CID 58291172) has the molecular formula C29H52O7 and a molecular weight of 512.73 g/mol. Its IUPAC name is [(E,2S,5S)-5-[(4S,6S)-6-ethyl-2-(methoxymethyl)-5,5-dimethyl-1,3-dioxan-4-yl]-3,4-dimethylhex-3-en-2-yl] (3R)-5-(methoxymethyl)-3-(2-methylpropyl)oxolane-2-carboxylate.
| Compound Name | [(E,2S,5S)-5-[(4S,6S)-6-ethyl-2-(methoxymethyl)-5,5-dimethyl-1,3-dioxan-4-yl]-3,4-dimethylhex-3-en-2-yl] (3R)-5-(methoxymethyl)-3-(2-methylpropyl)oxolane-2-carboxylate |
|---|---|
| PubChem CID | 58291172 |
| Molecular Formula | C29H52O7 |
| Molecular Weight | 512.73 g/mol |
| Exact Mass | 512.37 |
| IUPAC Name | [(E,2S,5S)-5-[(4S,6S)-6-ethyl-2-(methoxymethyl)-5,5-dimethyl-1,3-dioxan-4-yl]-3,4-dimethylhex-3-en-2-yl] (3R)-5-(methoxymethyl)-3-(2-methylpropyl)oxolane-2-carboxylate |
| SMILES | CC[C@@H]1OC(COC)O[C@@H]([C@@H](C)/C(C)=C(\C)[C@H](C)OC(=O)C2OC(COC)C[C@H]2CC(C)C)C1(C)C |
| InChI | InChI=1S/C29H52O7/c1-12-24-29(8,9)27(36-25(35-24)16-32-11)20(6)18(4)19(5)21(7)33-28(30)26-22(13-17(2)3)14-23(34-26)15-31-10/h17,20-27H,12-16H2,1-11H3/b19-18+/t20-,21-,22+,23?,24-,25?,26?,27-/m0/s1 |
| InChIKey | RSLSBBMGXZINRJ-SLAMYTEBSA-N |
| XLogP | 5.55 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.73 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|