About 1,4-diethyl-2,2-dimethyl-6-propan-2-yl-5-propan-2-ylidenepyridin-1-ium
1,4-diethyl-2,2-dimethyl-6-propan-2-yl-5-propan-2-ylidenepyridin-1-ium (PubChem CID 58291470) has the molecular formula C17H30N+
and a molecular weight of 248.43 g/mol. Its IUPAC name is 1,4-diethyl-2,2-dimethyl-6-propan-2-yl-5-propan-2-ylidenepyridin-1-ium.
Molecular Properties
| Compound Name | 1,4-diethyl-2,2-dimethyl-6-propan-2-yl-5-propan-2-ylidenepyridin-1-ium |
| PubChem CID | 58291470 |
| Molecular Formula | C17H30N+ |
| Molecular Weight | 248.43 g/mol |
| Exact Mass | 248.24 |
| IUPAC Name | 1,4-diethyl-2,2-dimethyl-6-propan-2-yl-5-propan-2-ylidenepyridin-1-ium |
| SMILES | CCC1=CC(C)(C)[N+](CC)=C(C(C)C)C1=C(C)C |
| InChI | InChI=1S/C17H30N/c1-9-14-11-17(7,8)18(10-2)16(13(5)6)15(14)12(3)4/h11,13H,9-10H2,1-8H3/q+1 |
| InChIKey | QPQZOVXYTUGIQN-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.43 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1,4-diethyl-2,2-dimethyl-6-propan-2-yl-5-propan-2-ylidenepyridin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-diethyl-2,2-dimethyl-6-propan-2-yl-5-propan-2-ylidenepyridin-1-ium?
The IUPAC name of 1,4-diethyl-2,2-dimethyl-6-propan-2-yl-5-propan-2-ylidenepyridin-1-ium (CID 58291470) is 1,4-diethyl-2,2-dimethyl-6-propan-2-yl-5-propan-2-ylidenepyridin-1-ium.
What is the SMILES notation for 1,4-diethyl-2,2-dimethyl-6-propan-2-yl-5-propan-2-ylidenepyridin-1-ium?
The canonical SMILES for 1,4-diethyl-2,2-dimethyl-6-propan-2-yl-5-propan-2-ylidenepyridin-1-ium is CCC1=CC(C)(C)[N+](CC)=C(C(C)C)C1=C(C)C.
What is the InChIKey of 1,4-diethyl-2,2-dimethyl-6-propan-2-yl-5-propan-2-ylidenepyridin-1-ium?
The InChIKey is QPQZOVXYTUGIQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H30N/c1-9-14-11-17(7,8)18(10-2)16(13(5)6)15(14)12(3)4/h11,13H,9-10H2,1-8H3/q+1.
What are the key properties of 1,4-diethyl-2,2-dimethyl-6-propan-2-yl-5-propan-2-ylidenepyridin-1-ium?
1,4-diethyl-2,2-dimethyl-6-propan-2-yl-5-propan-2-ylidenepyridin-1-ium has a molecular weight of 248.43 g/mol, XLogP of 4.58, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-diethyl-2,2-dimethyl-6-propan-2-yl-5-propan-2-ylidenepyridin-1-ium is sourced from PubChem (CID 58291470), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).