C18H28N+ — CID 58291551
6,6,8-trimethyl-1,9-di(propan-2-ylidene)-3,4-dihydro-2H-quinolizin-5-ium (PubChem CID 58291551) has the molecular formula C18H28N+ and a molecular weight of 258.43 g/mol. Its IUPAC name is 6,6,8-trimethyl-1,9-di(propan-2-ylidene)-3,4-dihydro-2H-quinolizin-5-ium.
| Compound Name | 6,6,8-trimethyl-1,9-di(propan-2-ylidene)-3,4-dihydro-2H-quinolizin-5-ium |
|---|---|
| PubChem CID | 58291551 |
| Molecular Formula | C18H28N+ |
| Molecular Weight | 258.43 g/mol |
| Exact Mass | 258.22 |
| IUPAC Name | 6,6,8-trimethyl-1,9-di(propan-2-ylidene)-3,4-dihydro-2H-quinolizin-5-ium |
| SMILES | CC1=CC(C)(C)[N+]2=C(C(=C(C)C)CCC2)C1=C(C)C |
| InChI | InChI=1S/C18H28N/c1-12(2)15-9-8-10-19-17(15)16(13(3)4)14(5)11-18(19,6)7/h11H,8-10H2,1-7H3/q+1 |
| InChIKey | KFHDQWYLBRJVBF-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.43 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|