C19H30N+ — CID 58291554
8-ethyl-6,6-dimethyl-1,9-di(propan-2-ylidene)-3,4-dihydro-2H-quinolizin-5-ium (PubChem CID 58291554) has the molecular formula C19H30N+ and a molecular weight of 272.46 g/mol. Its IUPAC name is 8-ethyl-6,6-dimethyl-1,9-di(propan-2-ylidene)-3,4-dihydro-2H-quinolizin-5-ium.
| Compound Name | 8-ethyl-6,6-dimethyl-1,9-di(propan-2-ylidene)-3,4-dihydro-2H-quinolizin-5-ium |
|---|---|
| PubChem CID | 58291554 |
| Molecular Formula | C19H30N+ |
| Molecular Weight | 272.46 g/mol |
| Exact Mass | 272.24 |
| IUPAC Name | 8-ethyl-6,6-dimethyl-1,9-di(propan-2-ylidene)-3,4-dihydro-2H-quinolizin-5-ium |
| SMILES | CCC1=CC(C)(C)[N+]2=C(C(=C(C)C)CCC2)C1=C(C)C |
| InChI | InChI=1S/C19H30N/c1-8-15-12-19(6,7)20-11-9-10-16(13(2)3)18(20)17(15)14(4)5/h12H,8-11H2,1-7H3/q+1 |
| InChIKey | STVFVNZJJHFECQ-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.46 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|