C9H5Cl2N3O2S — CID 58291660
6-amino-5-chloro-2-(5-chlorothiophen-2-yl)pyrimidine-4-carboxylic acid (PubChem CID 58291660) has the molecular formula C9H5Cl2N3O2S and a molecular weight of 290.13 g/mol. Its IUPAC name is 6-amino-5-chloro-2-(5-chlorothiophen-2-yl)pyrimidine-4-carboxylic acid.
| Compound Name | 6-amino-5-chloro-2-(5-chlorothiophen-2-yl)pyrimidine-4-carboxylic acid |
|---|---|
| PubChem CID | 58291660 |
| Molecular Formula | C9H5Cl2N3O2S |
| Molecular Weight | 290.13 g/mol |
| Exact Mass | 288.95 |
| IUPAC Name | 6-amino-5-chloro-2-(5-chlorothiophen-2-yl)pyrimidine-4-carboxylic acid |
| SMILES | Nc1nc(-c2ccc(Cl)s2)nc(C(=O)O)c1Cl |
| InChI | InChI=1S/C9H5Cl2N3O2S/c10-4-2-1-3(17-4)8-13-6(9(15)16)5(11)7(12)14-8/h1-2H,(H,15,16)(H2,12,13,14) |
| InChIKey | YHBXUHNKLGCBAG-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 89.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.13 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |