About 1-(4,6-dimethyl-5H-pyrimidin-5-id-2-yl)ethanone;yttrium
1-(4,6-dimethyl-5H-pyrimidin-5-id-2-yl)ethanone;yttrium (PubChem CID 58291662) has the molecular formula C8H9N2OY-
and a molecular weight of 238.08 g/mol. Its IUPAC name is 1-(4,6-dimethyl-5H-pyrimidin-5-id-2-yl)ethanone;yttrium.
Molecular Properties
| Compound Name | 1-(4,6-dimethyl-5H-pyrimidin-5-id-2-yl)ethanone;yttrium |
| PubChem CID | 58291662 |
| Molecular Formula | C8H9N2OY- |
| Molecular Weight | 238.08 g/mol |
| Exact Mass | 237.98 |
| IUPAC Name | 1-(4,6-dimethyl-5H-pyrimidin-5-id-2-yl)ethanone;yttrium |
| SMILES | CC(=O)c1nc(C)[c-]c(C)n1.[Y] |
| InChI | InChI=1S/C8H9N2O.Y/c1-5-4-6(2)10-8(9-5)7(3)11;/h1-3H3;/q-1; |
| InChIKey | LZLDPLZDCVBYEI-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.08 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 1-(4,6-dimethyl-5H-pyrimidin-5-id-2-yl)ethanone;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4,6-dimethyl-5H-pyrimidin-5-id-2-yl)ethanone;yttrium?
The IUPAC name of 1-(4,6-dimethyl-5H-pyrimidin-5-id-2-yl)ethanone;yttrium (CID 58291662) is 1-(4,6-dimethyl-5H-pyrimidin-5-id-2-yl)ethanone;yttrium.
What is the SMILES notation for 1-(4,6-dimethyl-5H-pyrimidin-5-id-2-yl)ethanone;yttrium?
The canonical SMILES for 1-(4,6-dimethyl-5H-pyrimidin-5-id-2-yl)ethanone;yttrium is CC(=O)c1nc(C)[c-]c(C)n1.[Y].
What is the InChIKey of 1-(4,6-dimethyl-5H-pyrimidin-5-id-2-yl)ethanone;yttrium?
The InChIKey is LZLDPLZDCVBYEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N2O.Y/c1-5-4-6(2)10-8(9-5)7(3)11;/h1-3H3;/q-1;.
What are the key properties of 1-(4,6-dimethyl-5H-pyrimidin-5-id-2-yl)ethanone;yttrium?
1-(4,6-dimethyl-5H-pyrimidin-5-id-2-yl)ethanone;yttrium has a molecular weight of 238.08 g/mol, XLogP of 1.09, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4,6-dimethyl-5H-pyrimidin-5-id-2-yl)ethanone;yttrium is sourced from PubChem (CID 58291662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).