About 4-(2-methanidylpropyl)-2,6-dimethyl-5H-pyrimidin-5-ide;vanadium;yttrium
4-(2-methanidylpropyl)-2,6-dimethyl-5H-pyrimidin-5-ide;vanadium;yttrium (PubChem CID 58291694) has the molecular formula C10H14N2VY-2
and a molecular weight of 302.09 g/mol. Its IUPAC name is 4-(2-methanidylpropyl)-2,6-dimethyl-5H-pyrimidin-5-ide;vanadium;yttrium.
Molecular Properties
| Compound Name | 4-(2-methanidylpropyl)-2,6-dimethyl-5H-pyrimidin-5-ide;vanadium;yttrium |
| PubChem CID | 58291694 |
| Molecular Formula | C10H14N2VY-2 |
| Molecular Weight | 302.09 g/mol |
| Exact Mass | 301.97 |
| IUPAC Name | 4-(2-methanidylpropyl)-2,6-dimethyl-5H-pyrimidin-5-ide;vanadium;yttrium |
| SMILES | [CH2-]C(C)Cc1[c-]c(C)nc(C)n1.[V].[Y] |
| InChI | InChI=1S/C10H14N2.V.Y/c1-7(2)5-10-6-8(3)11-9(4)12-10;;/h7H,1,5H2,2-4H3;;/q-2;; |
| InChIKey | RREIEBOGELFVIG-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.09 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-methanidylpropyl)-2,6-dimethyl-5H-pyrimidin-5-ide;vanadium;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-methanidylpropyl)-2,6-dimethyl-5H-pyrimidin-5-ide;vanadium;yttrium?
The IUPAC name of 4-(2-methanidylpropyl)-2,6-dimethyl-5H-pyrimidin-5-ide;vanadium;yttrium (CID 58291694) is 4-(2-methanidylpropyl)-2,6-dimethyl-5H-pyrimidin-5-ide;vanadium;yttrium.
What is the SMILES notation for 4-(2-methanidylpropyl)-2,6-dimethyl-5H-pyrimidin-5-ide;vanadium;yttrium?
The canonical SMILES for 4-(2-methanidylpropyl)-2,6-dimethyl-5H-pyrimidin-5-ide;vanadium;yttrium is [CH2-]C(C)Cc1[c-]c(C)nc(C)n1.[V].[Y].
What is the InChIKey of 4-(2-methanidylpropyl)-2,6-dimethyl-5H-pyrimidin-5-ide;vanadium;yttrium?
The InChIKey is RREIEBOGELFVIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2.V.Y/c1-7(2)5-10-6-8(3)11-9(4)12-10;;/h7H,1,5H2,2-4H3;;/q-2;;.
What are the key properties of 4-(2-methanidylpropyl)-2,6-dimethyl-5H-pyrimidin-5-ide;vanadium;yttrium?
4-(2-methanidylpropyl)-2,6-dimethyl-5H-pyrimidin-5-ide;vanadium;yttrium has a molecular weight of 302.09 g/mol, XLogP of 1.90, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-methanidylpropyl)-2,6-dimethyl-5H-pyrimidin-5-ide;vanadium;yttrium is sourced from PubChem (CID 58291694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).