About 2,6-dimethyl-5H-pyrimidin-5-id-4-amine;yttrium
2,6-dimethyl-5H-pyrimidin-5-id-4-amine;yttrium (PubChem CID 58291751) has the molecular formula C6H8N3Y-
and a molecular weight of 211.06 g/mol. Its IUPAC name is 2,6-dimethyl-5H-pyrimidin-5-id-4-amine;yttrium.
Molecular Properties
| Compound Name | 2,6-dimethyl-5H-pyrimidin-5-id-4-amine;yttrium |
| PubChem CID | 58291751 |
| Molecular Formula | C6H8N3Y- |
| Molecular Weight | 211.06 g/mol |
| Exact Mass | 210.98 |
| IUPAC Name | 2,6-dimethyl-5H-pyrimidin-5-id-4-amine;yttrium |
| SMILES | Cc1[c-]c(N)nc(C)n1.[Y] |
| InChI | InChI=1S/C6H8N3.Y/c1-4-3-6(7)9-5(2)8-4;/h1-2H3,(H2,7,8,9);/q-1; |
| InChIKey | PSOVQRSKOOAVPC-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.06 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 2,6-dimethyl-5H-pyrimidin-5-id-4-amine;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dimethyl-5H-pyrimidin-5-id-4-amine;yttrium?
The IUPAC name of 2,6-dimethyl-5H-pyrimidin-5-id-4-amine;yttrium (CID 58291751) is 2,6-dimethyl-5H-pyrimidin-5-id-4-amine;yttrium.
What is the SMILES notation for 2,6-dimethyl-5H-pyrimidin-5-id-4-amine;yttrium?
The canonical SMILES for 2,6-dimethyl-5H-pyrimidin-5-id-4-amine;yttrium is Cc1[c-]c(N)nc(C)n1.[Y].
What is the InChIKey of 2,6-dimethyl-5H-pyrimidin-5-id-4-amine;yttrium?
The InChIKey is PSOVQRSKOOAVPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N3.Y/c1-4-3-6(7)9-5(2)8-4;/h1-2H3,(H2,7,8,9);/q-1;.
What are the key properties of 2,6-dimethyl-5H-pyrimidin-5-id-4-amine;yttrium?
2,6-dimethyl-5H-pyrimidin-5-id-4-amine;yttrium has a molecular weight of 211.06 g/mol, XLogP of 0.47, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dimethyl-5H-pyrimidin-5-id-4-amine;yttrium is sourced from PubChem (CID 58291751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).