C10H15NO — CID 58291890
2-[(S)-amino(phenyl)methyl]-1,1,1,3,3,3-hexadeuterio(1,3-13C2)propan-2-ol (PubChem CID 58291890) has the molecular formula C10H15NO and a molecular weight of 173.26 g/mol. Its IUPAC name is 2-[(S)-amino(phenyl)methyl]-1,1,1,3,3,3-hexadeuterio(1,3-13C2)propan-2-ol.
| Compound Name | 2-[(S)-amino(phenyl)methyl]-1,1,1,3,3,3-hexadeuterio(1,3-13C2)propan-2-ol |
|---|---|
| PubChem CID | 58291890 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.16 |
| IUPAC Name | 2-[(S)-amino(phenyl)methyl]-1,1,1,3,3,3-hexadeuterio(1,3-13C2)propan-2-ol |
| SMILES | [2H][13C]([2H])([2H])C(O)([C@@H](N)c1ccccc1)[13C]([2H])([2H])[2H] |
| InChI | InChI=1S/C10H15NO/c1-10(2,12)9(11)8-6-4-3-5-7-8/h3-7,9,12H,11H2,1-2H3/t9-/m0/s1/i1+1D3,2+1D3 |
| InChIKey | FAKPSIGKWYUNJZ-NOHVQWCOSA-N |
| XLogP | 1.46 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |