C15H17F3O4S — CID 58292108
4-[[4-(trifluoromethyl)phenyl]sulfonylmethyl]cyclohexane-1-carboxylic acid (PubChem CID 58292108) has the molecular formula C15H17F3O4S and a molecular weight of 350.36 g/mol. Its IUPAC name is 4-[[4-(trifluoromethyl)phenyl]sulfonylmethyl]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[[4-(trifluoromethyl)phenyl]sulfonylmethyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 58292108 |
| Molecular Formula | C15H17F3O4S |
| Molecular Weight | 350.36 g/mol |
| Exact Mass | 350.08 |
| IUPAC Name | 4-[[4-(trifluoromethyl)phenyl]sulfonylmethyl]cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1CCC(CS(=O)(=O)c2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C15H17F3O4S/c16-15(17,18)12-5-7-13(8-6-12)23(21,22)9-10-1-3-11(4-2-10)14(19)20/h5-8,10-11H,1-4,9H2,(H,19,20) |
| InChIKey | FWAOIIWRCHGQKJ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.36 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |