C14H17N3O4S — CID 58292272
tert-butyl N-(4-pyrazol-1-ylphenyl)sulfonylcarbamate (PubChem CID 58292272) has the molecular formula C14H17N3O4S and a molecular weight of 323.37 g/mol. Its IUPAC name is tert-butyl N-(4-pyrazol-1-ylphenyl)sulfonylcarbamate.
| Compound Name | tert-butyl N-(4-pyrazol-1-ylphenyl)sulfonylcarbamate |
|---|---|
| PubChem CID | 58292272 |
| Molecular Formula | C14H17N3O4S |
| Molecular Weight | 323.37 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | tert-butyl N-(4-pyrazol-1-ylphenyl)sulfonylcarbamate |
| SMILES | CC(C)(C)OC(=O)NS(=O)(=O)c1ccc(-n2cccn2)cc1 |
| InChI | InChI=1S/C14H17N3O4S/c1-14(2,3)21-13(18)16-22(19,20)12-7-5-11(6-8-12)17-10-4-9-15-17/h4-10H,1-3H3,(H,16,18) |
| InChIKey | XSPGAUBTRUIHNE-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.37 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |