C13H20F8 — CID 58292446
4,4,6,6,8,8,10,10-octafluoro-2-methyldodecane (PubChem CID 58292446) has the molecular formula C13H20F8 and a molecular weight of 328.29 g/mol. Its IUPAC name is 4,4,6,6,8,8,10,10-octafluoro-2-methyldodecane.
| Compound Name | 4,4,6,6,8,8,10,10-octafluoro-2-methyldodecane |
|---|---|
| PubChem CID | 58292446 |
| Molecular Formula | C13H20F8 |
| Molecular Weight | 328.29 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | 4,4,6,6,8,8,10,10-octafluoro-2-methyldodecane |
| SMILES | CCC(F)(F)CC(F)(F)CC(F)(F)CC(F)(F)CC(C)C |
| InChI | InChI=1S/C13H20F8/c1-4-10(14,15)6-12(18,19)8-13(20,21)7-11(16,17)5-9(2)3/h9H,4-8H2,1-3H3 |
| InChIKey | SZSGWDBTBRCCFV-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.29 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |