C12H11BN2O5S — CID 58292729
2-[(3R)-1-hydroxy-4-methyl-6-(1,3,4-thiadiazol-2-yloxy)-3H-2,1-benzoxaborol-3-yl]acetic acid (PubChem CID 58292729) has the molecular formula C12H11BN2O5S and a molecular weight of 306.11 g/mol. Its IUPAC name is 2-[(3R)-1-hydroxy-4-methyl-6-(1,3,4-thiadiazol-2-yloxy)-3H-2,1-benzoxaborol-3-yl]acetic acid.
| Compound Name | 2-[(3R)-1-hydroxy-4-methyl-6-(1,3,4-thiadiazol-2-yloxy)-3H-2,1-benzoxaborol-3-yl]acetic acid |
|---|---|
| PubChem CID | 58292729 |
| Molecular Formula | C12H11BN2O5S |
| Molecular Weight | 306.11 g/mol |
| Exact Mass | 306.05 |
| IUPAC Name | 2-[(3R)-1-hydroxy-4-methyl-6-(1,3,4-thiadiazol-2-yloxy)-3H-2,1-benzoxaborol-3-yl]acetic acid |
| SMILES | Cc1cc(Oc2nncs2)cc2c1[C@@H](CC(=O)O)OB2O |
| InChI | InChI=1S/C12H11BN2O5S/c1-6-2-7(19-12-15-14-5-21-12)3-8-11(6)9(4-10(16)17)20-13(8)18/h2-3,5,9,18H,4H2,1H3,(H,16,17)/t9-/m1/s1 |
| InChIKey | YMJZTLUZTPMFQH-SECBINFHSA-N |
| XLogP | 0.87 |
| TPSA | 101.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.11 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|