C26H19FN6NaO3- — CID 58293243
sodium;N-(3-fluorophenyl)-2-[3-[[7-[4-(oxomethyl)phenyl]quinazolin-4-yl]amino]-1H-pyrazol-5-yl]acetamide;hydroxide (PubChem CID 58293243) has the molecular formula C26H19FN6NaO3- and a molecular weight of 505.47 g/mol. Its IUPAC name is sodium;N-(3-fluorophenyl)-2-[3-[[7-[4-(oxomethyl)phenyl]quinazolin-4-yl]amino]-1H-pyrazol-5-yl]acetamide;hydroxide.
| Compound Name | sodium;N-(3-fluorophenyl)-2-[3-[[7-[4-(oxomethyl)phenyl]quinazolin-4-yl]amino]-1H-pyrazol-5-yl]acetamide;hydroxide |
|---|---|
| PubChem CID | 58293243 |
| Molecular Formula | C26H19FN6NaO3- |
| Molecular Weight | 505.47 g/mol |
| Exact Mass | 505.14 |
| IUPAC Name | sodium;N-(3-fluorophenyl)-2-[3-[[7-[4-(oxomethyl)phenyl]quinazolin-4-yl]amino]-1H-pyrazol-5-yl]acetamide;hydroxide |
| SMILES | O=[C-]c1ccc(-c2ccc3c(Nc4cc(CC(=O)Nc5cccc(F)c5)[nH]n4)ncnc3c2)cc1.[Na+].[OH-] |
| InChI | InChI=1S/C26H18FN6O2.Na.H2O/c27-19-2-1-3-20(11-19)30-25(35)13-21-12-24(33-32-21)31-26-22-9-8-18(10-23(22)28-15-29-26)17-6-4-16(14-34)5-7-17;;/h1-12,15H,13H2,(H,30,35)(H2,28,29,31,32,33);;1H2/q-1;+1;/p-1 |
| InChIKey | LNZRXYWAXKXSLW-UHFFFAOYSA-M |
| XLogP | 1.37 |
| TPSA | 142.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.47 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|