About 3,3-difluoro-1,7-diazaspiro[3.4]octane
3,3-difluoro-1,7-diazaspiro[3.4]octane (PubChem CID 58293346) has the molecular formula C6H10F2N2
and a molecular weight of 148.16 g/mol. Its IUPAC name is 3,3-difluoro-1,7-diazaspiro[3.4]octane.
Molecular Properties
| Compound Name | 3,3-difluoro-1,7-diazaspiro[3.4]octane |
| PubChem CID | 58293346 |
| Molecular Formula | C6H10F2N2 |
| Molecular Weight | 148.16 g/mol |
| Exact Mass | 148.08 |
| IUPAC Name | 3,3-difluoro-1,7-diazaspiro[3.4]octane |
| SMILES | FC1(F)CNC12CCNC2 |
| InChI | InChI=1S/C6H10F2N2/c7-6(8)4-10-5(6)1-2-9-3-5/h9-10H,1-4H2 |
| InChIKey | IVYGBPSGSZGLQT-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.16 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,3-difluoro-1,7-diazaspiro[3.4]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-difluoro-1,7-diazaspiro[3.4]octane?
The IUPAC name of 3,3-difluoro-1,7-diazaspiro[3.4]octane (CID 58293346) is 3,3-difluoro-1,7-diazaspiro[3.4]octane.
What is the SMILES notation for 3,3-difluoro-1,7-diazaspiro[3.4]octane?
The canonical SMILES for 3,3-difluoro-1,7-diazaspiro[3.4]octane is FC1(F)CNC12CCNC2.
What is the InChIKey of 3,3-difluoro-1,7-diazaspiro[3.4]octane?
The InChIKey is IVYGBPSGSZGLQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10F2N2/c7-6(8)4-10-5(6)1-2-9-3-5/h9-10H,1-4H2.
What are the key properties of 3,3-difluoro-1,7-diazaspiro[3.4]octane?
3,3-difluoro-1,7-diazaspiro[3.4]octane has a molecular weight of 148.16 g/mol, XLogP of -0.04, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-difluoro-1,7-diazaspiro[3.4]octane is sourced from PubChem (CID 58293346), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).