C10H19N — CID 58293704
(6Z)-1,2,3-trimethyl-3,4,5,8-tetrahydro-2H-azocine (PubChem CID 58293704) has the molecular formula C10H19N and a molecular weight of 153.27 g/mol. Its IUPAC name is (6Z)-1,2,3-trimethyl-3,4,5,8-tetrahydro-2H-azocine.
| Compound Name | (6Z)-1,2,3-trimethyl-3,4,5,8-tetrahydro-2H-azocine |
|---|---|
| PubChem CID | 58293704 |
| Molecular Formula | C10H19N |
| Molecular Weight | 153.27 g/mol |
| Exact Mass | 153.15 |
| IUPAC Name | (6Z)-1,2,3-trimethyl-3,4,5,8-tetrahydro-2H-azocine |
| SMILES | CC1CC/C=C\CN(C)C1C |
| InChI | InChI=1S/C10H19N/c1-9-7-5-4-6-8-11(3)10(9)2/h4,6,9-10H,5,7-8H2,1-3H3/b6-4- |
| InChIKey | YMRPHOJXEAZZJY-XQRVVYSFSA-N |
| XLogP | 2.29 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.27 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|