C9H17NO — CID 58293713
(5Z)-2,3,4-trimethyl-2,3,7,8-tetrahydro-1,4-oxazocine (PubChem CID 58293713) has the molecular formula C9H17NO and a molecular weight of 155.24 g/mol. Its IUPAC name is (5Z)-2,3,4-trimethyl-2,3,7,8-tetrahydro-1,4-oxazocine.
| Compound Name | (5Z)-2,3,4-trimethyl-2,3,7,8-tetrahydro-1,4-oxazocine |
|---|---|
| PubChem CID | 58293713 |
| Molecular Formula | C9H17NO |
| Molecular Weight | 155.24 g/mol |
| Exact Mass | 155.13 |
| IUPAC Name | (5Z)-2,3,4-trimethyl-2,3,7,8-tetrahydro-1,4-oxazocine |
| SMILES | CC1OCC/C=C\N(C)C1C |
| InChI | InChI=1S/C9H17NO/c1-8-9(2)11-7-5-4-6-10(8)3/h4,6,8-9H,5,7H2,1-3H3/b6-4- |
| InChIKey | WXPKFLWOWKILKF-XQRVVYSFSA-N |
| XLogP | 1.63 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.24 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |