About (7Z)-1,2,3-trimethyl-3,4,5,6-tetrahydro-2H-azocine
(7Z)-1,2,3-trimethyl-3,4,5,6-tetrahydro-2H-azocine (PubChem CID 58293716) has the molecular formula C10H19N
and a molecular weight of 153.27 g/mol. Its IUPAC name is (7Z)-1,2,3-trimethyl-3,4,5,6-tetrahydro-2H-azocine.
Analyze (7Z)-1,2,3-trimethyl-3,4,5,6-tetrahydro-2H-azocine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7Z)-1,2,3-trimethyl-3,4,5,6-tetrahydro-2H-azocine?
The IUPAC name of (7Z)-1,2,3-trimethyl-3,4,5,6-tetrahydro-2H-azocine (CID 58293716) is (7Z)-1,2,3-trimethyl-3,4,5,6-tetrahydro-2H-azocine.
What is the SMILES notation for (7Z)-1,2,3-trimethyl-3,4,5,6-tetrahydro-2H-azocine?
The canonical SMILES for (7Z)-1,2,3-trimethyl-3,4,5,6-tetrahydro-2H-azocine is CC1CCC/C=C\N(C)C1C.
What is the InChIKey of (7Z)-1,2,3-trimethyl-3,4,5,6-tetrahydro-2H-azocine?
The InChIKey is GGQOJLZYJQPZLB-VURMDHGXSA-N. The full InChI is InChI=1S/C10H19N/c1-9-7-5-4-6-8-11(3)10(9)2/h6,8-10H,4-5,7H2,1-3H3/b8-6-.
What are the key properties of (7Z)-1,2,3-trimethyl-3,4,5,6-tetrahydro-2H-azocine?
(7Z)-1,2,3-trimethyl-3,4,5,6-tetrahydro-2H-azocine has a molecular weight of 153.27 g/mol, XLogP of 2.64, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (7Z)-1,2,3-trimethyl-3,4,5,6-tetrahydro-2H-azocine is sourced from PubChem (CID 58293716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).