About (7Z)-2,3-dimethyl-3,4,5,6-tetrahydro-2H-thiocine
(7Z)-2,3-dimethyl-3,4,5,6-tetrahydro-2H-thiocine (PubChem CID 58293733) has the molecular formula C9H16S
and a molecular weight of 156.29 g/mol. Its IUPAC name is (7Z)-2,3-dimethyl-3,4,5,6-tetrahydro-2H-thiocine.
Analyze (7Z)-2,3-dimethyl-3,4,5,6-tetrahydro-2H-thiocine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7Z)-2,3-dimethyl-3,4,5,6-tetrahydro-2H-thiocine?
The IUPAC name of (7Z)-2,3-dimethyl-3,4,5,6-tetrahydro-2H-thiocine (CID 58293733) is (7Z)-2,3-dimethyl-3,4,5,6-tetrahydro-2H-thiocine.
What is the SMILES notation for (7Z)-2,3-dimethyl-3,4,5,6-tetrahydro-2H-thiocine?
The canonical SMILES for (7Z)-2,3-dimethyl-3,4,5,6-tetrahydro-2H-thiocine is CC1CCC/C=C\SC1C.
What is the InChIKey of (7Z)-2,3-dimethyl-3,4,5,6-tetrahydro-2H-thiocine?
The InChIKey is WLCLZBUQBVXUAR-ALCCZGGFSA-N. The full InChI is InChI=1S/C9H16S/c1-8-6-4-3-5-7-10-9(8)2/h5,7-9H,3-4,6H2,1-2H3/b7-5-.
What are the key properties of (7Z)-2,3-dimethyl-3,4,5,6-tetrahydro-2H-thiocine?
(7Z)-2,3-dimethyl-3,4,5,6-tetrahydro-2H-thiocine has a molecular weight of 156.29 g/mol, XLogP of 3.44, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (7Z)-2,3-dimethyl-3,4,5,6-tetrahydro-2H-thiocine is sourced from PubChem (CID 58293733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).