C24H26N2O2 — CID 58294673
[(4aS)-7-methoxy-2,3,4a,5,6,10b-hexahydro-1H-benzo[f]quinolin-4-yl]-(1-methylindol-3-yl)methanone (PubChem CID 58294673) has the molecular formula C24H26N2O2 and a molecular weight of 374.48 g/mol. Its IUPAC name is [(4aS)-7-methoxy-2,3,4a,5,6,10b-hexahydro-1H-benzo[f]quinolin-4-yl]-(1-methylindol-3-yl)methanone.
| Compound Name | [(4aS)-7-methoxy-2,3,4a,5,6,10b-hexahydro-1H-benzo[f]quinolin-4-yl]-(1-methylindol-3-yl)methanone |
|---|---|
| PubChem CID | 58294673 |
| Molecular Formula | C24H26N2O2 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | [(4aS)-7-methoxy-2,3,4a,5,6,10b-hexahydro-1H-benzo[f]quinolin-4-yl]-(1-methylindol-3-yl)methanone |
| SMILES | COc1cccc2c1CC[C@H]1C2CCCN1C(=O)c1cn(C)c2ccccc12 |
| InChI | InChI=1S/C24H26N2O2/c1-25-15-20(18-7-3-4-10-21(18)25)24(27)26-14-6-9-17-16-8-5-11-23(28-2)19(16)12-13-22(17)26/h3-5,7-8,10-11,15,17,22H,6,9,12-14H2,1-2H3/t17?,22-/m0/s1 |
| InChIKey | UHIDIMBWIAJJQY-UGNFMNBCSA-N |
| XLogP | 4.52 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |