About 1-[4-(3-benzyl-7-methoxy-4-oxoquinazolin-6-yl)oxycyclohexyl]-1,3,3-trimethylurea
1-[4-(3-benzyl-7-methoxy-4-oxoquinazolin-6-yl)oxycyclohexyl]-1,3,3-trimethylurea (PubChem CID 58294900) has the molecular formula C26H32N4O4
and a molecular weight of 464.57 g/mol. Its IUPAC name is 1-[4-(3-benzyl-7-methoxy-4-oxoquinazolin-6-yl)oxycyclohexyl]-1,3,3-trimethylurea.
Molecular Properties
| Compound Name | 1-[4-(3-benzyl-7-methoxy-4-oxoquinazolin-6-yl)oxycyclohexyl]-1,3,3-trimethylurea |
| PubChem CID | 58294900 |
| Molecular Formula | C26H32N4O4 |
| Molecular Weight | 464.57 g/mol |
| Exact Mass | 464.24 |
| IUPAC Name | 1-[4-(3-benzyl-7-methoxy-4-oxoquinazolin-6-yl)oxycyclohexyl]-1,3,3-trimethylurea |
| SMILES | COc1cc2ncn(Cc3ccccc3)c(=O)c2cc1OC1CCC(N(C)C(=O)N(C)C)CC1 |
| InChI | InChI=1S/C26H32N4O4/c1-28(2)26(32)29(3)19-10-12-20(13-11-19)34-24-14-21-22(15-23(24)33-4)27-17-30(25(21)31)16-18-8-6-5-7-9-18/h5-9,14-15,17,19-20H,10-13,16H2,1-4H3 |
| InChIKey | CYZONAWTIYSVPL-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 76.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 464.57 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[4-(3-benzyl-7-methoxy-4-oxoquinazolin-6-yl)oxycyclohexyl]-1,3,3-trimethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(3-benzyl-7-methoxy-4-oxoquinazolin-6-yl)oxycyclohexyl]-1,3,3-trimethylurea?
The IUPAC name of 1-[4-(3-benzyl-7-methoxy-4-oxoquinazolin-6-yl)oxycyclohexyl]-1,3,3-trimethylurea (CID 58294900) is 1-[4-(3-benzyl-7-methoxy-4-oxoquinazolin-6-yl)oxycyclohexyl]-1,3,3-trimethylurea.
What is the SMILES notation for 1-[4-(3-benzyl-7-methoxy-4-oxoquinazolin-6-yl)oxycyclohexyl]-1,3,3-trimethylurea?
The canonical SMILES for 1-[4-(3-benzyl-7-methoxy-4-oxoquinazolin-6-yl)oxycyclohexyl]-1,3,3-trimethylurea is COc1cc2ncn(Cc3ccccc3)c(=O)c2cc1OC1CCC(N(C)C(=O)N(C)C)CC1.
What is the InChIKey of 1-[4-(3-benzyl-7-methoxy-4-oxoquinazolin-6-yl)oxycyclohexyl]-1,3,3-trimethylurea?
The InChIKey is CYZONAWTIYSVPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H32N4O4/c1-28(2)26(32)29(3)19-10-12-20(13-11-19)34-24-14-21-22(15-23(24)33-4)27-17-30(25(21)31)16-18-8-6-5-7-9-18/h5-9,14-15,17,19-20H,10-13,16H2,1-4H3.
What are the key properties of 1-[4-(3-benzyl-7-methoxy-4-oxoquinazolin-6-yl)oxycyclohexyl]-1,3,3-trimethylurea?
1-[4-(3-benzyl-7-methoxy-4-oxoquinazolin-6-yl)oxycyclohexyl]-1,3,3-trimethylurea has a molecular weight of 464.57 g/mol, XLogP of 3.76, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(3-benzyl-7-methoxy-4-oxoquinazolin-6-yl)oxycyclohexyl]-1,3,3-trimethylurea is sourced from PubChem (CID 58294900), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).