C21H17BrN2O4S — CID 58295091
N-(3-bromophenyl)-4-[(1R,2R,6S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]benzenesulfonamide (PubChem CID 58295091) has the molecular formula C21H17BrN2O4S and a molecular weight of 473.35 g/mol. Its IUPAC name is N-(3-bromophenyl)-4-[(1R,2R,6S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]benzenesulfonamide.
| Compound Name | N-(3-bromophenyl)-4-[(1R,2R,6S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 58295091 |
| Molecular Formula | C21H17BrN2O4S |
| Molecular Weight | 473.35 g/mol |
| Exact Mass | 472.01 |
| IUPAC Name | N-(3-bromophenyl)-4-[(1R,2R,6S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]benzenesulfonamide |
| SMILES | O=C1[C@@H]2[C@H]3C=CC(C3)[C@@H]2C(=O)N1c1ccc(S(=O)(=O)Nc2cccc(Br)c2)cc1 |
| InChI | InChI=1S/C21H17BrN2O4S/c22-14-2-1-3-15(11-14)23-29(27,28)17-8-6-16(7-9-17)24-20(25)18-12-4-5-13(10-12)19(18)21(24)26/h1-9,11-13,18-19,23H,10H2/t12-,13?,18+,19-/m0/s1 |
| InChIKey | FYKPGBMLLKRQQM-USOYXDPFSA-N |
| XLogP | 3.56 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.35 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|