About methyl 2-methoxyiminopropanoate
methyl 2-methoxyiminopropanoate (PubChem CID 582954) has the molecular formula C5H9NO3
and a molecular weight of 131.13 g/mol. Its IUPAC name is methyl 2-methoxyiminopropanoate.
Molecular Properties
| Compound Name | methyl 2-methoxyiminopropanoate |
| PubChem CID | 582954 |
| Molecular Formula | C5H9NO3 |
| Molecular Weight | 131.13 g/mol |
| Exact Mass | 131.06 |
| IUPAC Name | methyl 2-methoxyiminopropanoate |
| SMILES | CON=C(C)C(=O)OC |
| InChI | InChI=1S/C5H9NO3/c1-4(6-9-3)5(7)8-2/h1-3H3 |
| InChIKey | BCGGGYPDAARXDJ-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.13 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-methoxyiminopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-methoxyiminopropanoate?
The IUPAC name of methyl 2-methoxyiminopropanoate (CID 582954) is methyl 2-methoxyiminopropanoate.
What is the SMILES notation for methyl 2-methoxyiminopropanoate?
The canonical SMILES for methyl 2-methoxyiminopropanoate is CON=C(C)C(=O)OC.
What is the InChIKey of methyl 2-methoxyiminopropanoate?
The InChIKey is BCGGGYPDAARXDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9NO3/c1-4(6-9-3)5(7)8-2/h1-3H3.
What are the key properties of methyl 2-methoxyiminopropanoate?
methyl 2-methoxyiminopropanoate has a molecular weight of 131.13 g/mol, XLogP of 0.18, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-methoxyiminopropanoate is sourced from PubChem (CID 582954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).