C18H11F2N3O3S2 — CID 58295501
4-(2,3-difluoro-4-methylphenyl)-2-(imidazo[2,1-b][1,3]thiazole-6-carbonylamino)thiophene-3-carboxylic acid (PubChem CID 58295501) has the molecular formula C18H11F2N3O3S2 and a molecular weight of 419.43 g/mol. Its IUPAC name is 4-(2,3-difluoro-4-methylphenyl)-2-(imidazo[2,1-b][1,3]thiazole-6-carbonylamino)thiophene-3-carboxylic acid.
| Compound Name | 4-(2,3-difluoro-4-methylphenyl)-2-(imidazo[2,1-b][1,3]thiazole-6-carbonylamino)thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 58295501 |
| Molecular Formula | C18H11F2N3O3S2 |
| Molecular Weight | 419.43 g/mol |
| Exact Mass | 419.02 |
| IUPAC Name | 4-(2,3-difluoro-4-methylphenyl)-2-(imidazo[2,1-b][1,3]thiazole-6-carbonylamino)thiophene-3-carboxylic acid |
| SMILES | Cc1ccc(-c2csc(NC(=O)c3cn4ccsc4n3)c2C(=O)O)c(F)c1F |
| InChI | InChI=1S/C18H11F2N3O3S2/c1-8-2-3-9(14(20)13(8)19)10-7-28-16(12(10)17(25)26)22-15(24)11-6-23-4-5-27-18(23)21-11/h2-7H,1H3,(H,22,24)(H,25,26) |
| InChIKey | NCLOBNVQTFGFTM-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 83.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.43 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|