C17H10ClN5O3S — CID 58295516
4-(4-chlorophenyl)-2-([1,2,4]triazolo[1,5-a]pyrimidine-2-carbonylamino)thiophene-3-carboxylic acid (PubChem CID 58295516) has the molecular formula C17H10ClN5O3S and a molecular weight of 399.82 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-2-([1,2,4]triazolo[1,5-a]pyrimidine-2-carbonylamino)thiophene-3-carboxylic acid.
| Compound Name | 4-(4-chlorophenyl)-2-([1,2,4]triazolo[1,5-a]pyrimidine-2-carbonylamino)thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 58295516 |
| Molecular Formula | C17H10ClN5O3S |
| Molecular Weight | 399.82 g/mol |
| Exact Mass | 399.02 |
| IUPAC Name | 4-(4-chlorophenyl)-2-([1,2,4]triazolo[1,5-a]pyrimidine-2-carbonylamino)thiophene-3-carboxylic acid |
| SMILES | O=C(Nc1scc(-c2ccc(Cl)cc2)c1C(=O)O)c1nc2ncccn2n1 |
| InChI | InChI=1S/C17H10ClN5O3S/c18-10-4-2-9(3-5-10)11-8-27-15(12(11)16(25)26)21-14(24)13-20-17-19-6-1-7-23(17)22-13/h1-8H,(H,21,24)(H,25,26) |
| InChIKey | QKPXQOAMVYDEEO-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 109.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.82 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|