About 4'-bromospiro[2,3-dihydro-1H-pyridine-4,3'-2H-isoindole]-1'-one
4'-bromospiro[2,3-dihydro-1H-pyridine-4,3'-2H-isoindole]-1'-one (PubChem CID 58295744) has the molecular formula C12H11BrN2O
and a molecular weight of 279.14 g/mol. Its IUPAC name is 4'-bromospiro[2,3-dihydro-1H-pyridine-4,3'-2H-isoindole]-1'-one.
Molecular Properties
| Compound Name | 4'-bromospiro[2,3-dihydro-1H-pyridine-4,3'-2H-isoindole]-1'-one |
| PubChem CID | 58295744 |
| Molecular Formula | C12H11BrN2O |
| Molecular Weight | 279.14 g/mol |
| Exact Mass | 278.01 |
| IUPAC Name | 4'-bromospiro[2,3-dihydro-1H-pyridine-4,3'-2H-isoindole]-1'-one |
| SMILES | O=C1NC2(C=CNCC2)c2c(Br)cccc21 |
| InChI | InChI=1S/C12H11BrN2O/c13-9-3-1-2-8-10(9)12(15-11(8)16)4-6-14-7-5-12/h1-4,6,14H,5,7H2,(H,15,16) |
| InChIKey | UMRHWBDTRWKKCB-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.14 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4'-bromospiro[2,3-dihydro-1H-pyridine-4,3'-2H-isoindole]-1'-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4'-bromospiro[2,3-dihydro-1H-pyridine-4,3'-2H-isoindole]-1'-one?
The IUPAC name of 4'-bromospiro[2,3-dihydro-1H-pyridine-4,3'-2H-isoindole]-1'-one (CID 58295744) is 4'-bromospiro[2,3-dihydro-1H-pyridine-4,3'-2H-isoindole]-1'-one.
What is the SMILES notation for 4'-bromospiro[2,3-dihydro-1H-pyridine-4,3'-2H-isoindole]-1'-one?
The canonical SMILES for 4'-bromospiro[2,3-dihydro-1H-pyridine-4,3'-2H-isoindole]-1'-one is O=C1NC2(C=CNCC2)c2c(Br)cccc21.
What is the InChIKey of 4'-bromospiro[2,3-dihydro-1H-pyridine-4,3'-2H-isoindole]-1'-one?
The InChIKey is UMRHWBDTRWKKCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11BrN2O/c13-9-3-1-2-8-10(9)12(15-11(8)16)4-6-14-7-5-12/h1-4,6,14H,5,7H2,(H,15,16).
What are the key properties of 4'-bromospiro[2,3-dihydro-1H-pyridine-4,3'-2H-isoindole]-1'-one?
4'-bromospiro[2,3-dihydro-1H-pyridine-4,3'-2H-isoindole]-1'-one has a molecular weight of 279.14 g/mol, XLogP of 1.89, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4'-bromospiro[2,3-dihydro-1H-pyridine-4,3'-2H-isoindole]-1'-one is sourced from PubChem (CID 58295744), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).