C34H37N5O6S2 — CID 58295880
N-[(4R)-4-(3,4-dimethoxyphenyl)-4-[1,3-dioxo-4-[4-(pyridin-3-ylmethyl)piperazin-1-yl]isoindol-2-yl]butyl]thiophene-2-sulfonamide (PubChem CID 58295880) has the molecular formula C34H37N5O6S2 and a molecular weight of 675.83 g/mol. Its IUPAC name is N-[(4R)-4-(3,4-dimethoxyphenyl)-4-[1,3-dioxo-4-[4-(pyridin-3-ylmethyl)piperazin-1-yl]isoindol-2-yl]butyl]thiophene-2-sulfonamide.
| Compound Name | N-[(4R)-4-(3,4-dimethoxyphenyl)-4-[1,3-dioxo-4-[4-(pyridin-3-ylmethyl)piperazin-1-yl]isoindol-2-yl]butyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 58295880 |
| Molecular Formula | C34H37N5O6S2 |
| Molecular Weight | 675.83 g/mol |
| Exact Mass | 675.22 |
| IUPAC Name | N-[(4R)-4-(3,4-dimethoxyphenyl)-4-[1,3-dioxo-4-[4-(pyridin-3-ylmethyl)piperazin-1-yl]isoindol-2-yl]butyl]thiophene-2-sulfonamide |
| SMILES | COc1ccc([C@@H](CCCNS(=O)(=O)c2cccs2)N2C(=O)c3cccc(N4CCN(Cc5cccnc5)CC4)c3C2=O)cc1OC |
| InChI | InChI=1S/C34H37N5O6S2/c1-44-29-13-12-25(21-30(29)45-2)27(10-5-15-36-47(42,43)31-11-6-20-46-31)39-33(40)26-8-3-9-28(32(26)34(39)41)38-18-16-37(17-19-38)23-24-7-4-14-35-22-24/h3-4,6-9,11-14,20-22,27,36H,5,10,15-19,23H2,1-2H3/t27-/m1/s1 |
| InChIKey | UEKOOKMOSCEYKL-HHHXNRCGSA-N |
| XLogP | 4.58 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.83 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|