C36H42N6O6S — CID 58295900
N-[(4R)-4-(3,4-dimethoxyphenyl)-4-[1,3-dioxo-4-[4-[(1R)-1-phenylethyl]piperazin-1-yl]isoindol-2-yl]butyl]-1-methylpyrazole-4-sulfonamide (PubChem CID 58295900) has the molecular formula C36H42N6O6S and a molecular weight of 686.84 g/mol. Its IUPAC name is N-[(4R)-4-(3,4-dimethoxyphenyl)-4-[1,3-dioxo-4-[4-[(1R)-1-phenylethyl]piperazin-1-yl]isoindol-2-yl]butyl]-1-methylpyrazole-4-sulfonamide.
| Compound Name | N-[(4R)-4-(3,4-dimethoxyphenyl)-4-[1,3-dioxo-4-[4-[(1R)-1-phenylethyl]piperazin-1-yl]isoindol-2-yl]butyl]-1-methylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 58295900 |
| Molecular Formula | C36H42N6O6S |
| Molecular Weight | 686.84 g/mol |
| Exact Mass | 686.29 |
| IUPAC Name | N-[(4R)-4-(3,4-dimethoxyphenyl)-4-[1,3-dioxo-4-[4-[(1R)-1-phenylethyl]piperazin-1-yl]isoindol-2-yl]butyl]-1-methylpyrazole-4-sulfonamide |
| SMILES | COc1ccc([C@@H](CCCNS(=O)(=O)c2cnn(C)c2)N2C(=O)c3cccc(N4CCN([C@H](C)c5ccccc5)CC4)c3C2=O)cc1OC |
| InChI | InChI=1S/C36H42N6O6S/c1-25(26-10-6-5-7-11-26)40-18-20-41(21-19-40)31-13-8-12-29-34(31)36(44)42(35(29)43)30(27-15-16-32(47-3)33(22-27)48-4)14-9-17-38-49(45,46)28-23-37-39(2)24-28/h5-8,10-13,15-16,22-25,30,38H,9,14,17-21H2,1-4H3/t25-,30-/m1/s1 |
| InChIKey | QJODYSYLGVURLQ-FYBSXPHGSA-N |
| XLogP | 4.42 |
| TPSA | 126.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.84 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|