C33H37F2N3O5 — CID 58295901
2-[(1R)-4-[(2,6-difluorophenyl)methoxy]-1-(3,4-dimethoxyphenyl)butyl]-4-(4-ethylpiperazin-1-yl)isoindole-1,3-dione (PubChem CID 58295901) has the molecular formula C33H37F2N3O5 and a molecular weight of 593.67 g/mol. Its IUPAC name is 2-[(1R)-4-[(2,6-difluorophenyl)methoxy]-1-(3,4-dimethoxyphenyl)butyl]-4-(4-ethylpiperazin-1-yl)isoindole-1,3-dione.
| Compound Name | 2-[(1R)-4-[(2,6-difluorophenyl)methoxy]-1-(3,4-dimethoxyphenyl)butyl]-4-(4-ethylpiperazin-1-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 58295901 |
| Molecular Formula | C33H37F2N3O5 |
| Molecular Weight | 593.67 g/mol |
| Exact Mass | 593.27 |
| IUPAC Name | 2-[(1R)-4-[(2,6-difluorophenyl)methoxy]-1-(3,4-dimethoxyphenyl)butyl]-4-(4-ethylpiperazin-1-yl)isoindole-1,3-dione |
| SMILES | CCN1CCN(c2cccc3c2C(=O)N([C@H](CCCOCc2c(F)cccc2F)c2ccc(OC)c(OC)c2)C3=O)CC1 |
| InChI | InChI=1S/C33H37F2N3O5/c1-4-36-15-17-37(18-16-36)28-11-5-8-23-31(28)33(40)38(32(23)39)27(22-13-14-29(41-2)30(20-22)42-3)12-7-19-43-21-24-25(34)9-6-10-26(24)35/h5-6,8-11,13-14,20,27H,4,7,12,15-19,21H2,1-3H3/t27-/m1/s1 |
| InChIKey | IDDDFKIJAFYREI-HHHXNRCGSA-N |
| XLogP | 5.46 |
| TPSA | 71.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.67 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|