C36H40N6O4 — CID 58295921
2-[(1R)-1-(3,4-dimethoxyphenyl)-4-(pyrimidin-2-ylamino)butyl]-4-[4-[(1R)-1-phenylethyl]piperazin-1-yl]isoindole-1,3-dione (PubChem CID 58295921) has the molecular formula C36H40N6O4 and a molecular weight of 620.75 g/mol. Its IUPAC name is 2-[(1R)-1-(3,4-dimethoxyphenyl)-4-(pyrimidin-2-ylamino)butyl]-4-[4-[(1R)-1-phenylethyl]piperazin-1-yl]isoindole-1,3-dione.
| Compound Name | 2-[(1R)-1-(3,4-dimethoxyphenyl)-4-(pyrimidin-2-ylamino)butyl]-4-[4-[(1R)-1-phenylethyl]piperazin-1-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 58295921 |
| Molecular Formula | C36H40N6O4 |
| Molecular Weight | 620.75 g/mol |
| Exact Mass | 620.31 |
| IUPAC Name | 2-[(1R)-1-(3,4-dimethoxyphenyl)-4-(pyrimidin-2-ylamino)butyl]-4-[4-[(1R)-1-phenylethyl]piperazin-1-yl]isoindole-1,3-dione |
| SMILES | COc1ccc([C@@H](CCCNc2ncccn2)N2C(=O)c3cccc(N4CCN([C@H](C)c5ccccc5)CC4)c3C2=O)cc1OC |
| InChI | InChI=1S/C36H40N6O4/c1-25(26-10-5-4-6-11-26)40-20-22-41(23-21-40)30-13-7-12-28-33(30)35(44)42(34(28)43)29(14-8-17-37-36-38-18-9-19-39-36)27-15-16-31(45-2)32(24-27)46-3/h4-7,9-13,15-16,18-19,24-25,29H,8,14,17,20-23H2,1-3H3,(H,37,38,39)/t25-,29-/m1/s1 |
| InChIKey | ZSTGGHMJQBESCV-VAVYLYDRSA-N |
| XLogP | 5.61 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.75 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|