C37H43N5O7S — CID 58295926
N-[(4R)-4-(3,4-dimethoxyphenyl)-4-[1,3-dioxo-4-[4-[(1R)-1-phenylethyl]piperazin-1-yl]isoindol-2-yl]butyl]-3,5-dimethyl-1,2-oxazole-4-sulfonamide (PubChem CID 58295926) has the molecular formula C37H43N5O7S and a molecular weight of 701.85 g/mol. Its IUPAC name is N-[(4R)-4-(3,4-dimethoxyphenyl)-4-[1,3-dioxo-4-[4-[(1R)-1-phenylethyl]piperazin-1-yl]isoindol-2-yl]butyl]-3,5-dimethyl-1,2-oxazole-4-sulfonamide.
| Compound Name | N-[(4R)-4-(3,4-dimethoxyphenyl)-4-[1,3-dioxo-4-[4-[(1R)-1-phenylethyl]piperazin-1-yl]isoindol-2-yl]butyl]-3,5-dimethyl-1,2-oxazole-4-sulfonamide |
|---|---|
| PubChem CID | 58295926 |
| Molecular Formula | C37H43N5O7S |
| Molecular Weight | 701.85 g/mol |
| Exact Mass | 701.29 |
| IUPAC Name | N-[(4R)-4-(3,4-dimethoxyphenyl)-4-[1,3-dioxo-4-[4-[(1R)-1-phenylethyl]piperazin-1-yl]isoindol-2-yl]butyl]-3,5-dimethyl-1,2-oxazole-4-sulfonamide |
| SMILES | COc1ccc([C@@H](CCCNS(=O)(=O)c2c(C)noc2C)N2C(=O)c3cccc(N4CCN([C@H](C)c5ccccc5)CC4)c3C2=O)cc1OC |
| InChI | InChI=1S/C37H43N5O7S/c1-24-35(26(3)49-39-24)50(45,46)38-18-10-15-30(28-16-17-32(47-4)33(23-28)48-5)42-36(43)29-13-9-14-31(34(29)37(42)44)41-21-19-40(20-22-41)25(2)27-11-7-6-8-12-27/h6-9,11-14,16-17,23,25,30,38H,10,15,18-22H2,1-5H3/t25-,30-/m1/s1 |
| InChIKey | RGVROIUJZAXULG-FYBSXPHGSA-N |
| XLogP | 5.29 |
| TPSA | 134.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.85 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|