C36H41N5O6S2 — CID 58295948
N-[(4R)-4-(3,4-dimethoxyphenyl)-4-[1,3-dioxo-4-[4-[(1R)-1-phenylethyl]piperazin-1-yl]isoindol-2-yl]butyl]-2-methyl-1,3-thiazole-5-sulfonamide (PubChem CID 58295948) has the molecular formula C36H41N5O6S2 and a molecular weight of 703.89 g/mol. Its IUPAC name is N-[(4R)-4-(3,4-dimethoxyphenyl)-4-[1,3-dioxo-4-[4-[(1R)-1-phenylethyl]piperazin-1-yl]isoindol-2-yl]butyl]-2-methyl-1,3-thiazole-5-sulfonamide.
| Compound Name | N-[(4R)-4-(3,4-dimethoxyphenyl)-4-[1,3-dioxo-4-[4-[(1R)-1-phenylethyl]piperazin-1-yl]isoindol-2-yl]butyl]-2-methyl-1,3-thiazole-5-sulfonamide |
|---|---|
| PubChem CID | 58295948 |
| Molecular Formula | C36H41N5O6S2 |
| Molecular Weight | 703.89 g/mol |
| Exact Mass | 703.25 |
| IUPAC Name | N-[(4R)-4-(3,4-dimethoxyphenyl)-4-[1,3-dioxo-4-[4-[(1R)-1-phenylethyl]piperazin-1-yl]isoindol-2-yl]butyl]-2-methyl-1,3-thiazole-5-sulfonamide |
| SMILES | COc1ccc([C@@H](CCCNS(=O)(=O)c2cnc(C)s2)N2C(=O)c3cccc(N4CCN([C@H](C)c5ccccc5)CC4)c3C2=O)cc1OC |
| InChI | InChI=1S/C36H41N5O6S2/c1-24(26-10-6-5-7-11-26)39-18-20-40(21-19-39)30-13-8-12-28-34(30)36(43)41(35(28)42)29(27-15-16-31(46-3)32(22-27)47-4)14-9-17-38-49(44,45)33-23-37-25(2)48-33/h5-8,10-13,15-16,22-24,29,38H,9,14,17-21H2,1-4H3/t24-,29-/m1/s1 |
| InChIKey | DXNIJUPZOCOVBM-FUFSCUOVSA-N |
| XLogP | 5.45 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.89 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|