C30H33F3N4O6S2 — CID 58295993
N-[(4R)-4-(3,4-dimethoxyphenyl)-4-[1,3-dioxo-4-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]isoindol-2-yl]butyl]thiophene-2-sulfonamide (PubChem CID 58295993) has the molecular formula C30H33F3N4O6S2 and a molecular weight of 666.74 g/mol. Its IUPAC name is N-[(4R)-4-(3,4-dimethoxyphenyl)-4-[1,3-dioxo-4-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]isoindol-2-yl]butyl]thiophene-2-sulfonamide.
| Compound Name | N-[(4R)-4-(3,4-dimethoxyphenyl)-4-[1,3-dioxo-4-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]isoindol-2-yl]butyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 58295993 |
| Molecular Formula | C30H33F3N4O6S2 |
| Molecular Weight | 666.74 g/mol |
| Exact Mass | 666.18 |
| IUPAC Name | N-[(4R)-4-(3,4-dimethoxyphenyl)-4-[1,3-dioxo-4-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]isoindol-2-yl]butyl]thiophene-2-sulfonamide |
| SMILES | COc1ccc([C@@H](CCCNS(=O)(=O)c2cccs2)N2C(=O)c3cccc(N4CCN(CC(F)(F)F)CC4)c3C2=O)cc1OC |
| InChI | InChI=1S/C30H33F3N4O6S2/c1-42-24-11-10-20(18-25(24)43-2)22(8-4-12-34-45(40,41)26-9-5-17-44-26)37-28(38)21-6-3-7-23(27(21)29(37)39)36-15-13-35(14-16-36)19-30(31,32)33/h3,5-7,9-11,17-18,22,34H,4,8,12-16,19H2,1-2H3/t22-/m1/s1 |
| InChIKey | GRWDIVWCOLWTNN-JOCHJYFZSA-N |
| XLogP | 4.55 |
| TPSA | 108.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.74 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|