C38H46N6O6S — CID 58295999
N-[(4R)-4-(3,4-dimethoxyphenyl)-4-[1,3-dioxo-4-[4-[(1R)-1-phenylethyl]piperazin-1-yl]isoindol-2-yl]butyl]-1-ethyl-5-methylpyrazole-4-sulfonamide (PubChem CID 58295999) has the molecular formula C38H46N6O6S and a molecular weight of 714.89 g/mol. Its IUPAC name is N-[(4R)-4-(3,4-dimethoxyphenyl)-4-[1,3-dioxo-4-[4-[(1R)-1-phenylethyl]piperazin-1-yl]isoindol-2-yl]butyl]-1-ethyl-5-methylpyrazole-4-sulfonamide.
| Compound Name | N-[(4R)-4-(3,4-dimethoxyphenyl)-4-[1,3-dioxo-4-[4-[(1R)-1-phenylethyl]piperazin-1-yl]isoindol-2-yl]butyl]-1-ethyl-5-methylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 58295999 |
| Molecular Formula | C38H46N6O6S |
| Molecular Weight | 714.89 g/mol |
| Exact Mass | 714.32 |
| IUPAC Name | N-[(4R)-4-(3,4-dimethoxyphenyl)-4-[1,3-dioxo-4-[4-[(1R)-1-phenylethyl]piperazin-1-yl]isoindol-2-yl]butyl]-1-ethyl-5-methylpyrazole-4-sulfonamide |
| SMILES | CCn1ncc(S(=O)(=O)NCCC[C@H](c2ccc(OC)c(OC)c2)N2C(=O)c3cccc(N4CCN([C@H](C)c5ccccc5)CC4)c3C2=O)c1C |
| InChI | InChI=1S/C38H46N6O6S/c1-6-43-27(3)35(25-39-43)51(47,48)40-19-11-16-31(29-17-18-33(49-4)34(24-29)50-5)44-37(45)30-14-10-15-32(36(30)38(44)46)42-22-20-41(21-23-42)26(2)28-12-8-7-9-13-28/h7-10,12-15,17-18,24-26,31,40H,6,11,16,19-23H2,1-5H3/t26-,31-/m1/s1 |
| InChIKey | AOHNXYKSLGRNTI-MXBOTTGLSA-N |
| XLogP | 5.21 |
| TPSA | 126.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.89 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|