About 7-oxocyclohepta-1,3,5-triene-1-carbonitrile
7-oxocyclohepta-1,3,5-triene-1-carbonitrile (PubChem CID 582961) has the molecular formula C8H5NO
and a molecular weight of 131.13 g/mol. Its IUPAC name is 7-oxocyclohepta-1,3,5-triene-1-carbonitrile.
Molecular Properties
| Compound Name | 7-oxocyclohepta-1,3,5-triene-1-carbonitrile |
| PubChem CID | 582961 |
| Molecular Formula | C8H5NO |
| Molecular Weight | 131.13 g/mol |
| Exact Mass | 131.04 |
| IUPAC Name | 7-oxocyclohepta-1,3,5-triene-1-carbonitrile |
| SMILES | N#Cc1cccccc1=O |
| InChI | InChI=1S/C8H5NO/c9-6-7-4-2-1-3-5-8(7)10/h1-5H |
| InChIKey | UZTIHVRSZUIDTL-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.13 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-oxocyclohepta-1,3,5-triene-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-oxocyclohepta-1,3,5-triene-1-carbonitrile?
The IUPAC name of 7-oxocyclohepta-1,3,5-triene-1-carbonitrile (CID 582961) is 7-oxocyclohepta-1,3,5-triene-1-carbonitrile.
What is the SMILES notation for 7-oxocyclohepta-1,3,5-triene-1-carbonitrile?
The canonical SMILES for 7-oxocyclohepta-1,3,5-triene-1-carbonitrile is N#Cc1cccccc1=O.
What is the InChIKey of 7-oxocyclohepta-1,3,5-triene-1-carbonitrile?
The InChIKey is UZTIHVRSZUIDTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5NO/c9-6-7-4-2-1-3-5-8(7)10/h1-5H.
What are the key properties of 7-oxocyclohepta-1,3,5-triene-1-carbonitrile?
7-oxocyclohepta-1,3,5-triene-1-carbonitrile has a molecular weight of 131.13 g/mol, XLogP of 0.92, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-oxocyclohepta-1,3,5-triene-1-carbonitrile is sourced from PubChem (CID 582961), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).