C18H21ClN6O5S — CID 58296249
2-[(2R,3S,4R,5R)-5-[6-[(4-chlorophenyl)methylamino]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]ethanesulfonamide (PubChem CID 58296249) has the molecular formula C18H21ClN6O5S and a molecular weight of 468.92 g/mol. Its IUPAC name is 2-[(2R,3S,4R,5R)-5-[6-[(4-chlorophenyl)methylamino]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]ethanesulfonamide.
| Compound Name | 2-[(2R,3S,4R,5R)-5-[6-[(4-chlorophenyl)methylamino]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]ethanesulfonamide |
|---|---|
| PubChem CID | 58296249 |
| Molecular Formula | C18H21ClN6O5S |
| Molecular Weight | 468.92 g/mol |
| Exact Mass | 468.10 |
| IUPAC Name | 2-[(2R,3S,4R,5R)-5-[6-[(4-chlorophenyl)methylamino]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]ethanesulfonamide |
| SMILES | NS(=O)(=O)CC[C@H]1O[C@@H](n2cnc3c(NCc4ccc(Cl)cc4)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C18H21ClN6O5S/c19-11-3-1-10(2-4-11)7-21-16-13-17(23-8-22-16)25(9-24-13)18-15(27)14(26)12(30-18)5-6-31(20,28)29/h1-4,8-9,12,14-15,18,26-27H,5-7H2,(H2,20,28,29)(H,21,22,23)/t12-,14-,15-,18-/m1/s1 |
| InChIKey | SVFCEQURIOZBMA-SCFUHWHPSA-N |
| XLogP | 0.39 |
| TPSA | 165.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.92 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |