C17H17FN6O7S — CID 58296263
[(2R,3S,4R,5R)-5-[6-[(4-fluorobenzoyl)amino]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl sulfamate (PubChem CID 58296263) has the molecular formula C17H17FN6O7S and a molecular weight of 468.42 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-[6-[(4-fluorobenzoyl)amino]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl sulfamate.
| Compound Name | [(2R,3S,4R,5R)-5-[6-[(4-fluorobenzoyl)amino]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl sulfamate |
|---|---|
| PubChem CID | 58296263 |
| Molecular Formula | C17H17FN6O7S |
| Molecular Weight | 468.42 g/mol |
| Exact Mass | 468.09 |
| IUPAC Name | [(2R,3S,4R,5R)-5-[6-[(4-fluorobenzoyl)amino]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl sulfamate |
| SMILES | NS(=O)(=O)OC[C@H]1O[C@@H](n2cnc3c(NC(=O)c4ccc(F)cc4)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C17H17FN6O7S/c18-9-3-1-8(2-4-9)16(27)23-14-11-15(21-6-20-14)24(7-22-11)17-13(26)12(25)10(31-17)5-30-32(19,28)29/h1-4,6-7,10,12-13,17,25-26H,5H2,(H2,19,28,29)(H,20,21,23,27)/t10-,12-,13-,17-/m1/s1 |
| InChIKey | TVFRQGHNLSJLQN-CNEMSGBDSA-N |
| XLogP | -0.94 |
| TPSA | 191.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.42 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |