C29H41NO4 — CID 58296543
(1S,2S,6R,14R,15R,16R)-16-(cyclohexylmethoxymethyl)-11,15-dimethoxy-5-methyl-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11-triene (PubChem CID 58296543) has the molecular formula C29H41NO4 and a molecular weight of 467.65 g/mol. Its IUPAC name is (1S,2S,6R,14R,15R,16R)-16-(cyclohexylmethoxymethyl)-11,15-dimethoxy-5-methyl-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11-triene.
| Compound Name | (1S,2S,6R,14R,15R,16R)-16-(cyclohexylmethoxymethyl)-11,15-dimethoxy-5-methyl-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11-triene |
|---|---|
| PubChem CID | 58296543 |
| Molecular Formula | C29H41NO4 |
| Molecular Weight | 467.65 g/mol |
| Exact Mass | 467.30 |
| IUPAC Name | (1S,2S,6R,14R,15R,16R)-16-(cyclohexylmethoxymethyl)-11,15-dimethoxy-5-methyl-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11-triene |
| SMILES | COc1ccc2c3c1O[C@H]1[C@@]4(OC)CC[C@@]5(C[C@@H]4COCC4CCCCC4)[C@@H](C2)N(C)CC[C@]315 |
| InChI | InChI=1S/C29H41NO4/c1-30-14-13-28-24-20-9-10-22(31-2)25(24)34-26(28)29(32-3)12-11-27(28,23(30)15-20)16-21(29)18-33-17-19-7-5-4-6-8-19/h9-10,19,21,23,26H,4-8,11-18H2,1-3H3/t21-,23-,26-,27-,28+,29-/m1/s1 |
| InChIKey | CROXCUGUTMDKDP-ZYGOFEOWSA-N |
| XLogP | 4.74 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.65 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |