C31H37NO4 — CID 58296580
(1S,2S,6R,14R,15R,16R)-5-(cyclopropylmethyl)-11,15-dimethoxy-16-(phenoxymethyl)-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11-triene (PubChem CID 58296580) has the molecular formula C31H37NO4 and a molecular weight of 487.64 g/mol. Its IUPAC name is (1S,2S,6R,14R,15R,16R)-5-(cyclopropylmethyl)-11,15-dimethoxy-16-(phenoxymethyl)-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11-triene.
| Compound Name | (1S,2S,6R,14R,15R,16R)-5-(cyclopropylmethyl)-11,15-dimethoxy-16-(phenoxymethyl)-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11-triene |
|---|---|
| PubChem CID | 58296580 |
| Molecular Formula | C31H37NO4 |
| Molecular Weight | 487.64 g/mol |
| Exact Mass | 487.27 |
| IUPAC Name | (1S,2S,6R,14R,15R,16R)-5-(cyclopropylmethyl)-11,15-dimethoxy-16-(phenoxymethyl)-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11-triene |
| SMILES | COc1ccc2c3c1O[C@H]1[C@@]4(OC)CC[C@@]5(C[C@@H]4COc4ccccc4)[C@@H](C2)N(CC2CC2)CC[C@]315 |
| InChI | InChI=1S/C31H37NO4/c1-33-24-11-10-21-16-25-29-12-13-31(34-2,22(17-29)19-35-23-6-4-3-5-7-23)28-30(29,26(21)27(24)36-28)14-15-32(25)18-20-8-9-20/h3-7,10-11,20,22,25,28H,8-9,12-19H2,1-2H3/t22-,25-,28-,29-,30+,31-/m1/s1 |
| InChIKey | RNENEGUSAHUCOI-RRRALXMPSA-N |
| XLogP | 5.00 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.64 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |