C11H22F3N — CID 58297165
2,3,3-trimethyl-N-(4,4,4-trifluorobutyl)butan-2-amine (PubChem CID 58297165) has the molecular formula C11H22F3N and a molecular weight of 225.30 g/mol. Its IUPAC name is 2,3,3-trimethyl-N-(4,4,4-trifluorobutyl)butan-2-amine.
| Compound Name | 2,3,3-trimethyl-N-(4,4,4-trifluorobutyl)butan-2-amine |
|---|---|
| PubChem CID | 58297165 |
| Molecular Formula | C11H22F3N |
| Molecular Weight | 225.30 g/mol |
| Exact Mass | 225.17 |
| IUPAC Name | 2,3,3-trimethyl-N-(4,4,4-trifluorobutyl)butan-2-amine |
| SMILES | CC(C)(C)C(C)(C)NCCCC(F)(F)F |
| InChI | InChI=1S/C11H22F3N/c1-9(2,3)10(4,5)15-8-6-7-11(12,13)14/h15H,6-8H2,1-5H3 |
| InChIKey | ZVOCFRJQEHWBPZ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.30 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|