C17H25F3N2O3 — CID 58297254
1-[3-[1-(hydroxymethyl)cyclobutyl]-1,2-oxazol-5-yl]-3-methyl-3-(4,4,4-trifluorobutylamino)butan-2-one (PubChem CID 58297254) has the molecular formula C17H25F3N2O3 and a molecular weight of 362.39 g/mol. Its IUPAC name is 1-[3-[1-(hydroxymethyl)cyclobutyl]-1,2-oxazol-5-yl]-3-methyl-3-(4,4,4-trifluorobutylamino)butan-2-one.
| Compound Name | 1-[3-[1-(hydroxymethyl)cyclobutyl]-1,2-oxazol-5-yl]-3-methyl-3-(4,4,4-trifluorobutylamino)butan-2-one |
|---|---|
| PubChem CID | 58297254 |
| Molecular Formula | C17H25F3N2O3 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.18 |
| IUPAC Name | 1-[3-[1-(hydroxymethyl)cyclobutyl]-1,2-oxazol-5-yl]-3-methyl-3-(4,4,4-trifluorobutylamino)butan-2-one |
| SMILES | CC(C)(NCCCC(F)(F)F)C(=O)Cc1cc(C2(CO)CCC2)no1 |
| InChI | InChI=1S/C17H25F3N2O3/c1-15(2,21-8-4-7-17(18,19)20)14(24)10-12-9-13(22-25-12)16(11-23)5-3-6-16/h9,21,23H,3-8,10-11H2,1-2H3 |
| InChIKey | GCFUIIXVWXCEOB-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|