About 4,5-di(propan-2-yl)pyrrolo[1,2-b]pyridazine
4,5-di(propan-2-yl)pyrrolo[1,2-b]pyridazine (PubChem CID 58297681) has the molecular formula C13H18N2
and a molecular weight of 202.30 g/mol. Its IUPAC name is 4,5-di(propan-2-yl)pyrrolo[1,2-b]pyridazine.
Molecular Properties
| Compound Name | 4,5-di(propan-2-yl)pyrrolo[1,2-b]pyridazine |
| PubChem CID | 58297681 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | 4,5-di(propan-2-yl)pyrrolo[1,2-b]pyridazine |
| SMILES | CC(C)c1ccnn2ccc(C(C)C)c12 |
| InChI | InChI=1S/C13H18N2/c1-9(2)11-5-7-14-15-8-6-12(10(3)4)13(11)15/h5-10H,1-4H3 |
| InChIKey | XSRPCFNQANPGRH-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4,5-di(propan-2-yl)pyrrolo[1,2-b]pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-di(propan-2-yl)pyrrolo[1,2-b]pyridazine?
The IUPAC name of 4,5-di(propan-2-yl)pyrrolo[1,2-b]pyridazine (CID 58297681) is 4,5-di(propan-2-yl)pyrrolo[1,2-b]pyridazine.
What is the SMILES notation for 4,5-di(propan-2-yl)pyrrolo[1,2-b]pyridazine?
The canonical SMILES for 4,5-di(propan-2-yl)pyrrolo[1,2-b]pyridazine is CC(C)c1ccnn2ccc(C(C)C)c12.
What is the InChIKey of 4,5-di(propan-2-yl)pyrrolo[1,2-b]pyridazine?
The InChIKey is XSRPCFNQANPGRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N2/c1-9(2)11-5-7-14-15-8-6-12(10(3)4)13(11)15/h5-10H,1-4H3.
What are the key properties of 4,5-di(propan-2-yl)pyrrolo[1,2-b]pyridazine?
4,5-di(propan-2-yl)pyrrolo[1,2-b]pyridazine has a molecular weight of 202.30 g/mol, XLogP of 3.58, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-di(propan-2-yl)pyrrolo[1,2-b]pyridazine is sourced from PubChem (CID 58297681), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).