C20H31NO3 — CID 58297724
[(3S,4E)-1,3-dimethyl-12-oxo-2-[(2E)-penta-2,4-dien-2-yl]-1-azacyclododec-4-en-6-yl] acetate (PubChem CID 58297724) has the molecular formula C20H31NO3 and a molecular weight of 333.47 g/mol. Its IUPAC name is [(3S,4E)-1,3-dimethyl-12-oxo-2-[(2E)-penta-2,4-dien-2-yl]-1-azacyclododec-4-en-6-yl] acetate.
| Compound Name | [(3S,4E)-1,3-dimethyl-12-oxo-2-[(2E)-penta-2,4-dien-2-yl]-1-azacyclododec-4-en-6-yl] acetate |
|---|---|
| PubChem CID | 58297724 |
| Molecular Formula | C20H31NO3 |
| Molecular Weight | 333.47 g/mol |
| Exact Mass | 333.23 |
| IUPAC Name | [(3S,4E)-1,3-dimethyl-12-oxo-2-[(2E)-penta-2,4-dien-2-yl]-1-azacyclododec-4-en-6-yl] acetate |
| SMILES | C=C/C=C(\C)C1[C@@H](C)/C=C/C(OC(C)=O)CCCCCC(=O)N1C |
| InChI | InChI=1S/C20H31NO3/c1-6-10-15(2)20-16(3)13-14-18(24-17(4)22)11-8-7-9-12-19(23)21(20)5/h6,10,13-14,16,18,20H,1,7-9,11-12H2,2-5H3/b14-13+,15-10+/t16-,18?,20?/m0/s1 |
| InChIKey | MATDIGZKAPPJAB-NUIOLKGRSA-N |
| XLogP | 4.03 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.47 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|