C18H32INO2 — CID 58297738
7-hydroxy-N-[(1E,3S,4S,5E)-1-iodo-3,5-dimethylocta-1,5-dien-4-yl]-N-methylheptanamide (PubChem CID 58297738) has the molecular formula C18H32INO2 and a molecular weight of 421.36 g/mol. Its IUPAC name is 7-hydroxy-N-[(1E,3S,4S,5E)-1-iodo-3,5-dimethylocta-1,5-dien-4-yl]-N-methylheptanamide.
| Compound Name | 7-hydroxy-N-[(1E,3S,4S,5E)-1-iodo-3,5-dimethylocta-1,5-dien-4-yl]-N-methylheptanamide |
|---|---|
| PubChem CID | 58297738 |
| Molecular Formula | C18H32INO2 |
| Molecular Weight | 421.36 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | 7-hydroxy-N-[(1E,3S,4S,5E)-1-iodo-3,5-dimethylocta-1,5-dien-4-yl]-N-methylheptanamide |
| SMILES | CC/C=C(\C)[C@H]([C@@H](C)/C=C/I)N(C)C(=O)CCCCCCO |
| InChI | InChI=1S/C18H32INO2/c1-5-10-15(2)18(16(3)12-13-19)20(4)17(22)11-8-6-7-9-14-21/h10,12-13,16,18,21H,5-9,11,14H2,1-4H3/b13-12+,15-10+/t16-,18+/m0/s1 |
| InChIKey | SBNJZSUPKFCIKX-RYMCKFSZSA-N |
| XLogP | 4.70 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.36 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|