C17H30INO2 — CID 58297751
7-hydroxy-N-[(1E,3S,4S,5E)-1-iodo-3,5-dimethylocta-1,5-dien-4-yl]heptanamide (PubChem CID 58297751) has the molecular formula C17H30INO2 and a molecular weight of 407.34 g/mol. Its IUPAC name is 7-hydroxy-N-[(1E,3S,4S,5E)-1-iodo-3,5-dimethylocta-1,5-dien-4-yl]heptanamide.
| Compound Name | 7-hydroxy-N-[(1E,3S,4S,5E)-1-iodo-3,5-dimethylocta-1,5-dien-4-yl]heptanamide |
|---|---|
| PubChem CID | 58297751 |
| Molecular Formula | C17H30INO2 |
| Molecular Weight | 407.34 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | 7-hydroxy-N-[(1E,3S,4S,5E)-1-iodo-3,5-dimethylocta-1,5-dien-4-yl]heptanamide |
| SMILES | CC/C=C(\C)[C@@H](NC(=O)CCCCCCO)[C@@H](C)/C=C/I |
| InChI | InChI=1S/C17H30INO2/c1-4-9-14(2)17(15(3)11-12-18)19-16(21)10-7-5-6-8-13-20/h9,11-12,15,17,20H,4-8,10,13H2,1-3H3,(H,19,21)/b12-11+,14-9+/t15-,17+/m0/s1 |
| InChIKey | AMKUYOYXVKEDPR-PQHCIWPFSA-N |
| XLogP | 4.36 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.34 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|