About 3-nonyl-1-benzothiophene
3-nonyl-1-benzothiophene (PubChem CID 58298038) has the molecular formula C17H24S
and a molecular weight of 260.45 g/mol. Its IUPAC name is 3-nonyl-1-benzothiophene.
Molecular Properties
| Compound Name | 3-nonyl-1-benzothiophene |
| PubChem CID | 58298038 |
| Molecular Formula | C17H24S |
| Molecular Weight | 260.45 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | 3-nonyl-1-benzothiophene |
| SMILES | CCCCCCCCCc1csc2ccccc12 |
| InChI | InChI=1S/C17H24S/c1-2-3-4-5-6-7-8-11-15-14-18-17-13-10-9-12-16(15)17/h9-10,12-14H,2-8,11H2,1H3 |
| InChIKey | JRZQQILGBWLXDH-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 260.45 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-nonyl-1-benzothiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-nonyl-1-benzothiophene?
The IUPAC name of 3-nonyl-1-benzothiophene (CID 58298038) is 3-nonyl-1-benzothiophene.
What is the SMILES notation for 3-nonyl-1-benzothiophene?
The canonical SMILES for 3-nonyl-1-benzothiophene is CCCCCCCCCc1csc2ccccc12.
What is the InChIKey of 3-nonyl-1-benzothiophene?
The InChIKey is JRZQQILGBWLXDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24S/c1-2-3-4-5-6-7-8-11-15-14-18-17-13-10-9-12-16(15)17/h9-10,12-14H,2-8,11H2,1H3.
What are the key properties of 3-nonyl-1-benzothiophene?
3-nonyl-1-benzothiophene has a molecular weight of 260.45 g/mol, XLogP of 6.19, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-nonyl-1-benzothiophene is sourced from PubChem (CID 58298038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).