C38H70N4+4 — CID 58298252
(16E)-5,12,21,28-tetrazoniaheptacyclo[26.2.2.22,5.27,10.212,15.218,21.223,26]dotetracont-16-ene (PubChem CID 58298252) has the molecular formula C38H70N4+4 and a molecular weight of 583.01 g/mol. Its IUPAC name is (16E)-5,12,21,28-tetrazoniaheptacyclo[26.2.2.22,5.27,10.212,15.218,21.223,26]dotetracont-16-ene.
| Compound Name | (16E)-5,12,21,28-tetrazoniaheptacyclo[26.2.2.22,5.27,10.212,15.218,21.223,26]dotetracont-16-ene |
|---|---|
| PubChem CID | 58298252 |
| Molecular Formula | C38H70N4+4 |
| Molecular Weight | 583.01 g/mol |
| Exact Mass | 582.56 |
| IUPAC Name | (16E)-5,12,21,28-tetrazoniaheptacyclo[26.2.2.22,5.27,10.212,15.218,21.223,26]dotetracont-16-ene |
| SMILES | C1=C\C2CC[NH+](CC2)CC2CCC(CC2)C[NH+]2CCC(CC2)C2CC[NH+](CC2)CC2CCC(CC2)C[NH+]2CCC/1CC2 |
| InChI | InChI=1S/C38H66N4/c1-2-32-13-21-40(22-14-32)28-34-5-9-36(10-6-34)30-42-25-17-38(18-26-42)37-15-23-41(24-16-37)29-35-7-3-33(4-8-35)27-39-19-11-31(1)12-20-39/h1-2,31-38H,3-30H2/p+4/b2-1- |
| InChIKey | BIFCDQXDPNXALI-UPHRSURJSA-R |
| XLogP | 1.35 |
| TPSA | 17.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.01 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|