C36H26O8 — CID 58298285
4-[2-[4-[2-[4-[2-(4-formyloxyphenyl)ethynyl]phenyl]-4a,6,7,8a-tetrahydro-4H-[1,3]dioxino[4,5-b][1,4]dioxin-6-yl]phenyl]ethynyl]benzoic acid (PubChem CID 58298285) has the molecular formula C36H26O8 and a molecular weight of 586.60 g/mol. Its IUPAC name is 4-[2-[4-[2-[4-[2-(4-formyloxyphenyl)ethynyl]phenyl]-4a,6,7,8a-tetrahydro-4H-[1,3]dioxino[4,5-b][1,4]dioxin-6-yl]phenyl]ethynyl]benzoic acid.
| Compound Name | 4-[2-[4-[2-[4-[2-(4-formyloxyphenyl)ethynyl]phenyl]-4a,6,7,8a-tetrahydro-4H-[1,3]dioxino[4,5-b][1,4]dioxin-6-yl]phenyl]ethynyl]benzoic acid |
|---|---|
| PubChem CID | 58298285 |
| Molecular Formula | C36H26O8 |
| Molecular Weight | 586.60 g/mol |
| Exact Mass | 586.16 |
| IUPAC Name | 4-[2-[4-[2-[4-[2-(4-formyloxyphenyl)ethynyl]phenyl]-4a,6,7,8a-tetrahydro-4H-[1,3]dioxino[4,5-b][1,4]dioxin-6-yl]phenyl]ethynyl]benzoic acid |
| SMILES | O=COc1ccc(C#Cc2ccc(C3OCC4OC(c5ccc(C#Cc6ccc(C(=O)O)cc6)cc5)COC4O3)cc2)cc1 |
| InChI | InChI=1S/C36H26O8/c37-23-42-31-19-11-27(12-20-31)4-3-26-9-17-30(18-10-26)35-40-22-33-36(44-35)41-21-32(43-33)28-13-5-24(6-14-28)1-2-25-7-15-29(16-8-25)34(38)39/h5-20,23,32-33,35-36H,21-22H2,(H,38,39) |
| InChIKey | JYTCBJXVGFSNAC-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.60 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|